C12H24OS — CID 153306531
(4R)-4-(hydroxymethyl)-2,2,7-trimethyloctane-3-thione (PubChem CID 153306531) has the molecular formula C12H24OS and a molecular weight of 216.39 g/mol. Its IUPAC name is (4R)-4-(hydroxymethyl)-2,2,7-trimethyloctane-3-thione.
| Compound Name | (4R)-4-(hydroxymethyl)-2,2,7-trimethyloctane-3-thione |
|---|---|
| PubChem CID | 153306531 |
| Molecular Formula | C12H24OS |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (4R)-4-(hydroxymethyl)-2,2,7-trimethyloctane-3-thione |
| SMILES | CC(C)CC[C@H](CO)C(=S)C(C)(C)C |
| InChI | InChI=1S/C12H24OS/c1-9(2)6-7-10(8-13)11(14)12(3,4)5/h9-10,13H,6-8H2,1-5H3/t10-/m1/s1 |
| InChIKey | GNJAMFWTSUTPIY-SNVBAGLBSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|