C13H26S — CID 153306665
(4R)-2,2,4,8-tetramethylnonane-3-thione (PubChem CID 153306665) has the molecular formula C13H26S and a molecular weight of 214.42 g/mol. Its IUPAC name is (4R)-2,2,4,8-tetramethylnonane-3-thione.
| Compound Name | (4R)-2,2,4,8-tetramethylnonane-3-thione |
|---|---|
| PubChem CID | 153306665 |
| Molecular Formula | C13H26S |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | (4R)-2,2,4,8-tetramethylnonane-3-thione |
| SMILES | CC(C)CCC[C@@H](C)C(=S)C(C)(C)C |
| InChI | InChI=1S/C13H26S/c1-10(2)8-7-9-11(3)12(14)13(4,5)6/h10-11H,7-9H2,1-6H3/t11-/m1/s1 |
| InChIKey | WUEPLBJKZAONKC-LLVKDONJSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|