C13H26OS — CID 153306673
(4S)-4-(hydroxymethyl)-2,2,8-trimethylnonane-3-thione (PubChem CID 153306673) has the molecular formula C13H26OS and a molecular weight of 230.42 g/mol. Its IUPAC name is (4S)-4-(hydroxymethyl)-2,2,8-trimethylnonane-3-thione.
| Compound Name | (4S)-4-(hydroxymethyl)-2,2,8-trimethylnonane-3-thione |
|---|---|
| PubChem CID | 153306673 |
| Molecular Formula | C13H26OS |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (4S)-4-(hydroxymethyl)-2,2,8-trimethylnonane-3-thione |
| SMILES | CC(C)CCC[C@@H](CO)C(=S)C(C)(C)C |
| InChI | InChI=1S/C13H26OS/c1-10(2)7-6-8-11(9-14)12(15)13(3,4)5/h10-11,14H,6-9H2,1-5H3/t11-/m0/s1 |
| InChIKey | OQULAVMKHDWJEO-NSHDSACASA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|