C14H31NO — CID 115895057
4,4-dimethyl-2-(5-methylhexan-2-ylamino)pentan-1-ol (PubChem CID 115895057) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is 4,4-dimethyl-2-(5-methylhexan-2-ylamino)pentan-1-ol.
| Compound Name | 4,4-dimethyl-2-(5-methylhexan-2-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 115895057 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | 4,4-dimethyl-2-(5-methylhexan-2-ylamino)pentan-1-ol |
| SMILES | CC(C)CCC(C)NC(CO)CC(C)(C)C |
| InChI | InChI=1S/C14H31NO/c1-11(2)7-8-12(3)15-13(10-16)9-14(4,5)6/h11-13,15-16H,7-10H2,1-6H3 |
| InChIKey | KLCRXRUGJQTGFL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |