C14H29NO — CID 115895050
2-(1-cyclopentylethylamino)-4,4-dimethylpentan-1-ol (PubChem CID 115895050) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 2-(1-cyclopentylethylamino)-4,4-dimethylpentan-1-ol.
| Compound Name | 2-(1-cyclopentylethylamino)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 115895050 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 2-(1-cyclopentylethylamino)-4,4-dimethylpentan-1-ol |
| SMILES | CC(NC(CO)CC(C)(C)C)C1CCCC1 |
| InChI | InChI=1S/C14H29NO/c1-11(12-7-5-6-8-12)15-13(10-16)9-14(2,3)4/h11-13,15-16H,5-10H2,1-4H3 |
| InChIKey | WZEDXJCQEZJXOU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |