C15H31NO — CID 113438636
3-(1-cyclohexylethylamino)-4,4-dimethylpentan-1-ol (PubChem CID 113438636) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is 3-(1-cyclohexylethylamino)-4,4-dimethylpentan-1-ol.
| Compound Name | 3-(1-cyclohexylethylamino)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 113438636 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 3-(1-cyclohexylethylamino)-4,4-dimethylpentan-1-ol |
| SMILES | CC(NC(CCO)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C15H31NO/c1-12(13-8-6-5-7-9-13)16-14(10-11-17)15(2,3)4/h12-14,16-17H,5-11H2,1-4H3 |
| InChIKey | CFGUQLGBWWJUOY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |