C13H26O2 — CID 153298947
(4R,5S)-4-hydroxy-2,2,5,7,7-pentamethyloctan-3-one (PubChem CID 153298947) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is (4R,5S)-4-hydroxy-2,2,5,7,7-pentamethyloctan-3-one.
| Compound Name | (4R,5S)-4-hydroxy-2,2,5,7,7-pentamethyloctan-3-one |
|---|---|
| PubChem CID | 153298947 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | (4R,5S)-4-hydroxy-2,2,5,7,7-pentamethyloctan-3-one |
| SMILES | C[C@@H](CC(C)(C)C)[C@@H](O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C13H26O2/c1-9(8-12(2,3)4)10(14)11(15)13(5,6)7/h9-10,14H,8H2,1-7H3/t9-,10+/m0/s1 |
| InChIKey | NSOFDUSQRQLBAH-VHSXEESVSA-N |
| XLogP | 3.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |