2-hydroxy-3,5,5-trimethylhexanoic acid

C9H18O3 — CID 83906054

IUPAC2-hydroxy-3,5,5-trimethylhexanoic acid
SMILESCC(CC(C)(C)C)C(O)C(=O)O
InChIInChI=1S/C9H18O3/c1-6(5-9(2,3)4)7(10)8(11)12/h6-7,10H,5H2,1-4H3,(H,11,12)
InChIKeyDRVDMFWAHOTLIF-UHFFFAOYSA-N
MW174.24 g/mol
LogP1.50
Rot. Bonds3

About 2-hydroxy-3,5,5-trimethylhexanoic acid

2-hydroxy-3,5,5-trimethylhexanoic acid (PubChem CID 83906054) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-hydroxy-3,5,5-trimethylhexanoic acid.

Molecular Properties

Compound Name2-hydroxy-3,5,5-trimethylhexanoic acid
PubChem CID83906054
Molecular FormulaC9H18O3
Molecular Weight174.24 g/mol
Exact Mass174.13
IUPAC Name2-hydroxy-3,5,5-trimethylhexanoic acid
SMILESCC(CC(C)(C)C)C(O)C(=O)O
InChIInChI=1S/C9H18O3/c1-6(5-9(2,3)4)7(10)8(11)12/h6-7,10H,5H2,1-4H3,(H,11,12)
InChIKeyDRVDMFWAHOTLIF-UHFFFAOYSA-N
XLogP1.50
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.24
LogP ≤ 51.50
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-hydroxy-3,5,5-trimethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-3,5,5-trimethylhexanoic acid?
The IUPAC name of 2-hydroxy-3,5,5-trimethylhexanoic acid (CID 83906054) is 2-hydroxy-3,5,5-trimethylhexanoic acid.
What is the SMILES notation for 2-hydroxy-3,5,5-trimethylhexanoic acid?
The canonical SMILES for 2-hydroxy-3,5,5-trimethylhexanoic acid is CC(CC(C)(C)C)C(O)C(=O)O.
What is the InChIKey of 2-hydroxy-3,5,5-trimethylhexanoic acid?
The InChIKey is DRVDMFWAHOTLIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3/c1-6(5-9(2,3)4)7(10)8(11)12/h6-7,10H,5H2,1-4H3,(H,11,12).
What are the key properties of 2-hydroxy-3,5,5-trimethylhexanoic acid?
2-hydroxy-3,5,5-trimethylhexanoic acid has a molecular weight of 174.24 g/mol, XLogP of 1.50, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3,5,5-trimethylhexanoic acid is sourced from PubChem (CID 83906054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).