C13H26O2 — CID 153298834
(4R)-4-hydroxy-2,2,5,5,6,6-hexamethylheptan-3-one (PubChem CID 153298834) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is (4R)-4-hydroxy-2,2,5,5,6,6-hexamethylheptan-3-one.
| Compound Name | (4R)-4-hydroxy-2,2,5,5,6,6-hexamethylheptan-3-one |
|---|---|
| PubChem CID | 153298834 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | (4R)-4-hydroxy-2,2,5,5,6,6-hexamethylheptan-3-one |
| SMILES | CC(C)(C)C(=O)[C@H](O)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O2/c1-11(2,3)9(14)10(15)13(7,8)12(4,5)6/h10,15H,1-8H3/t10-/m0/s1 |
| InChIKey | MVNIYIWDOLOXIP-JTQLQIEISA-N |
| XLogP | 3.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |