C9H19NO2 — CID 88908613
(4R)-4-amino-5-hydroxy-2,2,5-trimethylhexan-3-one (PubChem CID 88908613) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is (4R)-4-amino-5-hydroxy-2,2,5-trimethylhexan-3-one.
| Compound Name | (4R)-4-amino-5-hydroxy-2,2,5-trimethylhexan-3-one |
|---|---|
| PubChem CID | 88908613 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (4R)-4-amino-5-hydroxy-2,2,5-trimethylhexan-3-one |
| SMILES | CC(C)(C)C(=O)[C@H](N)C(C)(C)O |
| InChI | InChI=1S/C9H19NO2/c1-8(2,3)7(11)6(10)9(4,5)12/h6,12H,10H2,1-5H3/t6-/m0/s1 |
| InChIKey | QLQZKVMMVFLJHY-LURJTMIESA-N |
| XLogP | 0.70 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |