C10H19ClO — CID 11183114
4-chloro-2,2,5,5-tetramethylhexan-3-one (PubChem CID 11183114) has the molecular formula C10H19ClO and a molecular weight of 190.71 g/mol. Its IUPAC name is 4-chloro-2,2,5,5-tetramethylhexan-3-one.
| Compound Name | 4-chloro-2,2,5,5-tetramethylhexan-3-one |
|---|---|
| PubChem CID | 11183114 |
| Molecular Formula | C10H19ClO |
| Molecular Weight | 190.71 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 4-chloro-2,2,5,5-tetramethylhexan-3-one |
| SMILES | CC(C)(C)C(=O)C(Cl)C(C)(C)C |
| InChI | InChI=1S/C10H19ClO/c1-9(2,3)7(11)8(12)10(4,5)6/h7H,1-6H3 |
| InChIKey | OWGFUGBHWAZCQH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.71 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|