C13H27NO — CID 59750018
(4S)-2,2,5,5-tetramethyl-4-(propan-2-ylamino)hexan-3-one (PubChem CID 59750018) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is (4S)-2,2,5,5-tetramethyl-4-(propan-2-ylamino)hexan-3-one.
| Compound Name | (4S)-2,2,5,5-tetramethyl-4-(propan-2-ylamino)hexan-3-one |
|---|---|
| PubChem CID | 59750018 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | (4S)-2,2,5,5-tetramethyl-4-(propan-2-ylamino)hexan-3-one |
| SMILES | CC(C)N[C@H](C(=O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H27NO/c1-9(2)14-10(12(3,4)5)11(15)13(6,7)8/h9-10,14H,1-8H3/t10-/m1/s1 |
| InChIKey | MLZVUHKDHXFXCF-SNVBAGLBSA-N |
| XLogP | 3.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |