C17H35NO — CID 121263476
4-(tert-butylamino)-2,2,5,5,7-pentamethyloctan-3-one (PubChem CID 121263476) has the molecular formula C17H35NO and a molecular weight of 269.47 g/mol. Its IUPAC name is 4-(tert-butylamino)-2,2,5,5,7-pentamethyloctan-3-one.
| Compound Name | 4-(tert-butylamino)-2,2,5,5,7-pentamethyloctan-3-one |
|---|---|
| PubChem CID | 121263476 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | 4-(tert-butylamino)-2,2,5,5,7-pentamethyloctan-3-one |
| SMILES | CC(C)CC(C)(C)C(NC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C17H35NO/c1-12(2)11-17(9,10)13(18-16(6,7)8)14(19)15(3,4)5/h12-13,18H,11H2,1-10H3 |
| InChIKey | WVQDMVOEZVJCPX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |