C10H19NO2 — CID 163676270
N-(3,5-dimethyl-2-oxohexan-3-yl)acetamide (PubChem CID 163676270) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is N-(3,5-dimethyl-2-oxohexan-3-yl)acetamide.
| Compound Name | N-(3,5-dimethyl-2-oxohexan-3-yl)acetamide |
|---|---|
| PubChem CID | 163676270 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | N-(3,5-dimethyl-2-oxohexan-3-yl)acetamide |
| SMILES | CC(=O)NC(C)(CC(C)C)C(C)=O |
| InChI | InChI=1S/C10H19NO2/c1-7(2)6-10(5,8(3)12)11-9(4)13/h7H,6H2,1-5H3,(H,11,13) |
| InChIKey | JGYXLGSZJKBVIH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |