C13H26O — CID 130306251
3,5,5-trimethyl-3-(2-methylpropyl)hexan-2-one (PubChem CID 130306251) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is 3,5,5-trimethyl-3-(2-methylpropyl)hexan-2-one.
| Compound Name | 3,5,5-trimethyl-3-(2-methylpropyl)hexan-2-one |
|---|---|
| PubChem CID | 130306251 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 3,5,5-trimethyl-3-(2-methylpropyl)hexan-2-one |
| SMILES | CC(=O)C(C)(CC(C)C)CC(C)(C)C |
| InChI | InChI=1S/C13H26O/c1-10(2)8-13(7,11(3)14)9-12(4,5)6/h10H,8-9H2,1-7H3 |
| InChIKey | CETXGYVPVNAEPN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |