C16H37N — CID 177149060
N-ethylethanamine;2,2,4,4,6-pentamethylheptane (PubChem CID 177149060) has the molecular formula C16H37N and a molecular weight of 243.48 g/mol. Its IUPAC name is N-ethylethanamine;2,2,4,4,6-pentamethylheptane.
| Compound Name | N-ethylethanamine;2,2,4,4,6-pentamethylheptane |
|---|---|
| PubChem CID | 177149060 |
| Molecular Formula | C16H37N |
| Molecular Weight | 243.48 g/mol |
| Exact Mass | 243.29 |
| IUPAC Name | N-ethylethanamine;2,2,4,4,6-pentamethylheptane |
| SMILES | CC(C)CC(C)(C)CC(C)(C)C.CCNCC |
| InChI | InChI=1S/C12H26.C4H11N/c1-10(2)8-12(6,7)9-11(3,4)5;1-3-5-4-2/h10H,8-9H2,1-7H3;5H,3-4H2,1-2H3 |
| InChIKey | VDQQVMNEEIJOEW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |