C11H23NOS — CID 130318731
(2S)-2-(tert-butylamino)-4,4-dimethyl-1-sulfanylpentan-3-one (PubChem CID 130318731) has the molecular formula C11H23NOS and a molecular weight of 217.38 g/mol. Its IUPAC name is (2S)-2-(tert-butylamino)-4,4-dimethyl-1-sulfanylpentan-3-one.
| Compound Name | (2S)-2-(tert-butylamino)-4,4-dimethyl-1-sulfanylpentan-3-one |
|---|---|
| PubChem CID | 130318731 |
| Molecular Formula | C11H23NOS |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (2S)-2-(tert-butylamino)-4,4-dimethyl-1-sulfanylpentan-3-one |
| SMILES | CC(C)(C)N[C@H](CS)C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H23NOS/c1-10(2,3)9(13)8(7-14)12-11(4,5)6/h8,12,14H,7H2,1-6H3/t8-/m1/s1 |
| InChIKey | OUJLITQJXCAAKL-MRVPVSSYSA-N |
| XLogP | 2.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|