C15H33N4O+ — CID 169301958
[(5S)-5-(tert-butylamino)-7,7-dimethyl-6-oxooctyl]-(diaminomethylidene)azanium (PubChem CID 169301958) has the molecular formula C15H33N4O+ and a molecular weight of 285.46 g/mol. Its IUPAC name is [(5S)-5-(tert-butylamino)-7,7-dimethyl-6-oxooctyl]-(diaminomethylidene)azanium.
| Compound Name | [(5S)-5-(tert-butylamino)-7,7-dimethyl-6-oxooctyl]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 169301958 |
| Molecular Formula | C15H33N4O+ |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.26 |
| IUPAC Name | [(5S)-5-(tert-butylamino)-7,7-dimethyl-6-oxooctyl]-(diaminomethylidene)azanium |
| SMILES | CC(C)(C)N[C@@H](CCCC[NH+]=C(N)N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H32N4O/c1-14(2,3)12(20)11(19-15(4,5)6)9-7-8-10-18-13(16)17/h11,19H,7-10H2,1-6H3,(H4,16,17,18)/p+1/t11-/m0/s1 |
| InChIKey | XKQQJJFWUKLPNQ-NSHDSACASA-O |
| XLogP | -0.12 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|