C21H44N3O3+ — CID 174314737
[(2R)-4-[[(5S)-5-(tert-butylamino)-7,7-dimethyl-6-oxooctyl]amino]-2-hydroxy-4-oxobutyl]-trimethylazanium (PubChem CID 174314737) has the molecular formula C21H44N3O3+ and a molecular weight of 386.60 g/mol. Its IUPAC name is [(2R)-4-[[(5S)-5-(tert-butylamino)-7,7-dimethyl-6-oxooctyl]amino]-2-hydroxy-4-oxobutyl]-trimethylazanium.
| Compound Name | [(2R)-4-[[(5S)-5-(tert-butylamino)-7,7-dimethyl-6-oxooctyl]amino]-2-hydroxy-4-oxobutyl]-trimethylazanium |
|---|---|
| PubChem CID | 174314737 |
| Molecular Formula | C21H44N3O3+ |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 386.34 |
| IUPAC Name | [(2R)-4-[[(5S)-5-(tert-butylamino)-7,7-dimethyl-6-oxooctyl]amino]-2-hydroxy-4-oxobutyl]-trimethylazanium |
| SMILES | CC(C)(C)N[C@@H](CCCCNC(=O)C[C@@H](O)C[N+](C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C21H43N3O3/c1-20(2,3)19(27)17(23-21(4,5)6)12-10-11-13-22-18(26)14-16(25)15-24(7,8)9/h16-17,23,25H,10-15H2,1-9H3/p+1/t16-,17+/m1/s1 |
| InChIKey | OQCCSBZXFIWDKX-SJORKVTESA-O |
| XLogP | 2.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|