C21H42N2O8 — CID 141333201
3,6,8-trihydroxy-N-[3-(3,6,8-trihydroxynonanoylamino)propyl]nonanamide (PubChem CID 141333201) has the molecular formula C21H42N2O8 and a molecular weight of 450.57 g/mol. Its IUPAC name is 3,6,8-trihydroxy-N-[3-(3,6,8-trihydroxynonanoylamino)propyl]nonanamide.
| Compound Name | 3,6,8-trihydroxy-N-[3-(3,6,8-trihydroxynonanoylamino)propyl]nonanamide |
|---|---|
| PubChem CID | 141333201 |
| Molecular Formula | C21H42N2O8 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 3,6,8-trihydroxy-N-[3-(3,6,8-trihydroxynonanoylamino)propyl]nonanamide |
| SMILES | CC(O)CC(O)CCC(O)CC(=O)NCCCNC(=O)CC(O)CCC(O)CC(C)O |
| InChI | InChI=1S/C21H42N2O8/c1-14(24)10-16(26)4-6-18(28)12-20(30)22-8-3-9-23-21(31)13-19(29)7-5-17(27)11-15(2)25/h14-19,24-29H,3-13H2,1-2H3,(H,22,30)(H,23,31) |
| InChIKey | GZFKNDDTOXRMQR-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 179.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|