C11H24N2O — CID 58520717
1-amino-2-(tert-butylamino)-4,4-dimethylpentan-3-one (PubChem CID 58520717) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 1-amino-2-(tert-butylamino)-4,4-dimethylpentan-3-one.
| Compound Name | 1-amino-2-(tert-butylamino)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 58520717 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 1-amino-2-(tert-butylamino)-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)NC(CN)C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H24N2O/c1-10(2,3)9(14)8(7-12)13-11(4,5)6/h8,13H,7,12H2,1-6H3 |
| InChIKey | VTWKYEJKSGNHHA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |