C15H29NO3S — CID 134274101
2-[(2R)-2-(tert-butylamino)-4,4-dimethyl-3-oxopentyl]sulfanylethyl acetate (PubChem CID 134274101) has the molecular formula C15H29NO3S and a molecular weight of 303.47 g/mol. Its IUPAC name is 2-[(2R)-2-(tert-butylamino)-4,4-dimethyl-3-oxopentyl]sulfanylethyl acetate.
| Compound Name | 2-[(2R)-2-(tert-butylamino)-4,4-dimethyl-3-oxopentyl]sulfanylethyl acetate |
|---|---|
| PubChem CID | 134274101 |
| Molecular Formula | C15H29NO3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2-[(2R)-2-(tert-butylamino)-4,4-dimethyl-3-oxopentyl]sulfanylethyl acetate |
| SMILES | CC(=O)OCCSC[C@H](NC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H29NO3S/c1-11(17)19-8-9-20-10-12(16-15(5,6)7)13(18)14(2,3)4/h12,16H,8-10H2,1-7H3/t12-/m0/s1 |
| InChIKey | HSNXNRXWMKJZEM-LBPRGKRZSA-N |
| XLogP | 2.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|