C22H40N4O8S — CID 123177141
[2-[[2-acetamido-3-(2-acetyloxyethylsulfanyl)propanoyl]amino]-3-methoxy-3-oxopropyl] 2,5-diamino-3,3,5-trimethylhexanoate (PubChem CID 123177141) has the molecular formula C22H40N4O8S and a molecular weight of 520.65 g/mol. Its IUPAC name is [2-[[2-acetamido-3-(2-acetyloxyethylsulfanyl)propanoyl]amino]-3-methoxy-3-oxopropyl] 2,5-diamino-3,3,5-trimethylhexanoate.
| Compound Name | [2-[[2-acetamido-3-(2-acetyloxyethylsulfanyl)propanoyl]amino]-3-methoxy-3-oxopropyl] 2,5-diamino-3,3,5-trimethylhexanoate |
|---|---|
| PubChem CID | 123177141 |
| Molecular Formula | C22H40N4O8S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | [2-[[2-acetamido-3-(2-acetyloxyethylsulfanyl)propanoyl]amino]-3-methoxy-3-oxopropyl] 2,5-diamino-3,3,5-trimethylhexanoate |
| SMILES | COC(=O)C(COC(=O)C(N)C(C)(C)CC(C)(C)N)NC(=O)C(CSCCOC(C)=O)NC(C)=O |
| InChI | InChI=1S/C22H40N4O8S/c1-13(27)25-16(11-35-9-8-33-14(2)28)18(29)26-15(19(30)32-7)10-34-20(31)17(23)21(3,4)12-22(5,6)24/h15-17H,8-12,23-24H2,1-7H3,(H,25,27)(H,26,29) |
| InChIKey | PTMIVAICFDINFK-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 189.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|