C19H37NO5S — CID 138574659
2-[3-[(3S)-3-(tert-butylamino)-5,5-dimethyl-4-oxohexyl]sulfanyl-2-hydroxypropoxy]ethyl acetate (PubChem CID 138574659) has the molecular formula C19H37NO5S and a molecular weight of 391.57 g/mol. Its IUPAC name is 2-[3-[(3S)-3-(tert-butylamino)-5,5-dimethyl-4-oxohexyl]sulfanyl-2-hydroxypropoxy]ethyl acetate.
| Compound Name | 2-[3-[(3S)-3-(tert-butylamino)-5,5-dimethyl-4-oxohexyl]sulfanyl-2-hydroxypropoxy]ethyl acetate |
|---|---|
| PubChem CID | 138574659 |
| Molecular Formula | C19H37NO5S |
| Molecular Weight | 391.57 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 2-[3-[(3S)-3-(tert-butylamino)-5,5-dimethyl-4-oxohexyl]sulfanyl-2-hydroxypropoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCC(O)CSCC[C@H](NC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C19H37NO5S/c1-14(21)25-10-9-24-12-15(22)13-26-11-8-16(20-19(5,6)7)17(23)18(2,3)4/h15-16,20,22H,8-13H2,1-7H3/t15?,16-/m0/s1 |
| InChIKey | MPTMIIOLUXXCAE-LYKKTTPLSA-N |
| XLogP | 2.42 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.57 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|