C12H22O5S — CID 158781731
2-[3-[(3S)-3-ethyl-4-oxopentyl]sulfanyl-2-hydroxypropoxy]acetic acid (PubChem CID 158781731) has the molecular formula C12H22O5S and a molecular weight of 278.37 g/mol. Its IUPAC name is 2-[3-[(3S)-3-ethyl-4-oxopentyl]sulfanyl-2-hydroxypropoxy]acetic acid.
| Compound Name | 2-[3-[(3S)-3-ethyl-4-oxopentyl]sulfanyl-2-hydroxypropoxy]acetic acid |
|---|---|
| PubChem CID | 158781731 |
| Molecular Formula | C12H22O5S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[3-[(3S)-3-ethyl-4-oxopentyl]sulfanyl-2-hydroxypropoxy]acetic acid |
| SMILES | CC[C@@H](CCSCC(O)COCC(=O)O)C(C)=O |
| InChI | InChI=1S/C12H22O5S/c1-3-10(9(2)13)4-5-18-8-11(14)6-17-7-12(15)16/h10-11,14H,3-8H2,1-2H3,(H,15,16)/t10-,11?/m0/s1 |
| InChIKey | IRDZKYNFKUPLBZ-VUWPPUDQSA-N |
| XLogP | 1.19 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|