C9H19NO3S — CID 57060848
(2R)-2-amino-3-(4-hydroxyhexylsulfanyl)propanoic acid (PubChem CID 57060848) has the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. Its IUPAC name is (2R)-2-amino-3-(4-hydroxyhexylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(4-hydroxyhexylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 57060848 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (2R)-2-amino-3-(4-hydroxyhexylsulfanyl)propanoic acid |
| SMILES | CCC(O)CCCSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H19NO3S/c1-2-7(11)4-3-5-14-6-8(10)9(12)13/h7-8,11H,2-6,10H2,1H3,(H,12,13)/t7?,8-/m0/s1 |
| InChIKey | QGRSQQXYHKHTQW-MQWKRIRWSA-N |
| XLogP | 0.68 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|