C9H16F3NO2S — CID 123605968
2-amino-3-(6,6,6-trifluorohexylsulfanyl)propanoic acid (PubChem CID 123605968) has the molecular formula C9H16F3NO2S and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-amino-3-(6,6,6-trifluorohexylsulfanyl)propanoic acid.
| Compound Name | 2-amino-3-(6,6,6-trifluorohexylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 123605968 |
| Molecular Formula | C9H16F3NO2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-amino-3-(6,6,6-trifluorohexylsulfanyl)propanoic acid |
| SMILES | NC(CSCCCCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H16F3NO2S/c10-9(11,12)4-2-1-3-5-16-6-7(13)8(14)15/h7H,1-6,13H2,(H,14,15) |
| InChIKey | ALVPDLZGAPEJGU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|