C9H18O4S — CID 105353371
2-(3-ethoxy-2-hydroxypropyl)sulfanylbutanoic acid (PubChem CID 105353371) has the molecular formula C9H18O4S and a molecular weight of 222.31 g/mol. Its IUPAC name is 2-(3-ethoxy-2-hydroxypropyl)sulfanylbutanoic acid.
| Compound Name | 2-(3-ethoxy-2-hydroxypropyl)sulfanylbutanoic acid |
|---|---|
| PubChem CID | 105353371 |
| Molecular Formula | C9H18O4S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-(3-ethoxy-2-hydroxypropyl)sulfanylbutanoic acid |
| SMILES | CCOCC(O)CSC(CC)C(=O)O |
| InChI | InChI=1S/C9H18O4S/c1-3-8(9(11)12)14-6-7(10)5-13-4-2/h7-8,10H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | NLPORQSLDIAKPM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |