C10H14O5S — CID 63943925
5-(3-ethoxy-2-hydroxypropyl)sulfanylfuran-2-carboxylic acid (PubChem CID 63943925) has the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. Its IUPAC name is 5-(3-ethoxy-2-hydroxypropyl)sulfanylfuran-2-carboxylic acid.
| Compound Name | 5-(3-ethoxy-2-hydroxypropyl)sulfanylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 63943925 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 5-(3-ethoxy-2-hydroxypropyl)sulfanylfuran-2-carboxylic acid |
| SMILES | CCOCC(O)CSc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C10H14O5S/c1-2-14-5-7(11)6-16-9-4-3-8(15-9)10(12)13/h3-4,7,11H,2,5-6H2,1H3,(H,12,13) |
| InChIKey | KWFYONIHJCJJFR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |