C10H12O3S — CID 66044939
5-(2-methylidenebutylsulfanyl)furan-2-carboxylic acid (PubChem CID 66044939) has the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. Its IUPAC name is 5-(2-methylidenebutylsulfanyl)furan-2-carboxylic acid.
| Compound Name | 5-(2-methylidenebutylsulfanyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 66044939 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 5-(2-methylidenebutylsulfanyl)furan-2-carboxylic acid |
| SMILES | C=C(CC)CSc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C10H12O3S/c1-3-7(2)6-14-9-5-4-8(13-9)10(11)12/h4-5H,2-3,6H2,1H3,(H,11,12) |
| InChIKey | AHNOSJCOEGJXBV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|