C9H12O4S — CID 66104193
5-(3-hydroxy-2-methylpropyl)sulfanylfuran-2-carboxylic acid (PubChem CID 66104193) has the molecular formula C9H12O4S and a molecular weight of 216.26 g/mol. Its IUPAC name is 5-(3-hydroxy-2-methylpropyl)sulfanylfuran-2-carboxylic acid.
| Compound Name | 5-(3-hydroxy-2-methylpropyl)sulfanylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 66104193 |
| Molecular Formula | C9H12O4S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 5-(3-hydroxy-2-methylpropyl)sulfanylfuran-2-carboxylic acid |
| SMILES | CC(CO)CSc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C9H12O4S/c1-6(4-10)5-14-8-3-2-7(13-8)9(11)12/h2-3,6,10H,4-5H2,1H3,(H,11,12) |
| InChIKey | GAIHNRAUYGNQAW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |