C11H16O5S — CID 63987361
5-(2-hydroxy-3-propan-2-yloxypropyl)sulfanylfuran-2-carboxylic acid (PubChem CID 63987361) has the molecular formula C11H16O5S and a molecular weight of 260.31 g/mol. Its IUPAC name is 5-(2-hydroxy-3-propan-2-yloxypropyl)sulfanylfuran-2-carboxylic acid.
| Compound Name | 5-(2-hydroxy-3-propan-2-yloxypropyl)sulfanylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 63987361 |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 5-(2-hydroxy-3-propan-2-yloxypropyl)sulfanylfuran-2-carboxylic acid |
| SMILES | CC(C)OCC(O)CSc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C11H16O5S/c1-7(2)15-5-8(12)6-17-10-4-3-9(16-10)11(13)14/h3-4,7-8,12H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | CUFOMZLGOHLCPK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |