C10H21NO4S — CID 106442618
(2R)-2-amino-3-(3-ethoxy-2-hydroxypropyl)sulfanyl-3-methylbutanoic acid (PubChem CID 106442618) has the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. Its IUPAC name is (2R)-2-amino-3-(3-ethoxy-2-hydroxypropyl)sulfanyl-3-methylbutanoic acid.
| Compound Name | (2R)-2-amino-3-(3-ethoxy-2-hydroxypropyl)sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106442618 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (2R)-2-amino-3-(3-ethoxy-2-hydroxypropyl)sulfanyl-3-methylbutanoic acid |
| SMILES | CCOCC(O)CSC(C)(C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H21NO4S/c1-4-15-5-7(12)6-16-10(2,3)8(11)9(13)14/h7-8,12H,4-6,11H2,1-3H3,(H,13,14)/t7?,8-/m1/s1 |
| InChIKey | CCEZXBKVJIQTSJ-BRFYHDHCSA-N |
| XLogP | 0.31 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |