C12H20O7S — CID 59705729
2-[3-(2-ethoxyethoxy)-2-methyl-3-oxopropyl]sulfanylbutanedioic acid (PubChem CID 59705729) has the molecular formula C12H20O7S and a molecular weight of 308.35 g/mol. Its IUPAC name is 2-[3-(2-ethoxyethoxy)-2-methyl-3-oxopropyl]sulfanylbutanedioic acid.
| Compound Name | 2-[3-(2-ethoxyethoxy)-2-methyl-3-oxopropyl]sulfanylbutanedioic acid |
|---|---|
| PubChem CID | 59705729 |
| Molecular Formula | C12H20O7S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-[3-(2-ethoxyethoxy)-2-methyl-3-oxopropyl]sulfanylbutanedioic acid |
| SMILES | CCOCCOC(=O)C(C)CSC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H20O7S/c1-3-18-4-5-19-12(17)8(2)7-20-9(11(15)16)6-10(13)14/h8-9H,3-7H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | KPVZYGRCSPIKNG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|