C16H26O8S — CID 139651939
2-(1,4-dibutoxy-1,4-dioxobutan-2-yl)sulfanylbutanedioic acid (PubChem CID 139651939) has the molecular formula C16H26O8S and a molecular weight of 378.44 g/mol. Its IUPAC name is 2-(1,4-dibutoxy-1,4-dioxobutan-2-yl)sulfanylbutanedioic acid.
| Compound Name | 2-(1,4-dibutoxy-1,4-dioxobutan-2-yl)sulfanylbutanedioic acid |
|---|---|
| PubChem CID | 139651939 |
| Molecular Formula | C16H26O8S |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 2-(1,4-dibutoxy-1,4-dioxobutan-2-yl)sulfanylbutanedioic acid |
| SMILES | CCCCOC(=O)CC(SC(CC(=O)O)C(=O)O)C(=O)OCCCC |
| InChI | InChI=1S/C16H26O8S/c1-3-5-7-23-14(19)10-12(16(22)24-8-6-4-2)25-11(15(20)21)9-13(17)18/h11-12H,3-10H2,1-2H3,(H,17,18)(H,20,21) |
| InChIKey | BXCCGHRBTBRLEU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|