C15H29N3O2 — CID 88612328
(E)-4-amino-N-[2-(tert-butylamino)-4,4-dimethyl-3-oxopentyl]but-2-enamide (PubChem CID 88612328) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is (E)-4-amino-N-[2-(tert-butylamino)-4,4-dimethyl-3-oxopentyl]but-2-enamide.
| Compound Name | (E)-4-amino-N-[2-(tert-butylamino)-4,4-dimethyl-3-oxopentyl]but-2-enamide |
|---|---|
| PubChem CID | 88612328 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | (E)-4-amino-N-[2-(tert-butylamino)-4,4-dimethyl-3-oxopentyl]but-2-enamide |
| SMILES | CC(C)(C)NC(CNC(=O)/C=C/CN)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H29N3O2/c1-14(2,3)13(20)11(18-15(4,5)6)10-17-12(19)8-7-9-16/h7-8,11,18H,9-10,16H2,1-6H3,(H,17,19)/b8-7+ |
| InChIKey | UUVAPEHSWBXMNK-BQYQJAHWSA-N |
| XLogP | 0.99 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|