C21H35N5O2 — CID 169301953
(2S)-N-[(2S)-2-(tert-butylamino)-4,4-dimethyl-3-oxopentyl]-2-(diaminomethylideneamino)-3-phenylpropanamide (PubChem CID 169301953) has the molecular formula C21H35N5O2 and a molecular weight of 389.54 g/mol. Its IUPAC name is (2S)-N-[(2S)-2-(tert-butylamino)-4,4-dimethyl-3-oxopentyl]-2-(diaminomethylideneamino)-3-phenylpropanamide.
| Compound Name | (2S)-N-[(2S)-2-(tert-butylamino)-4,4-dimethyl-3-oxopentyl]-2-(diaminomethylideneamino)-3-phenylpropanamide |
|---|---|
| PubChem CID | 169301953 |
| Molecular Formula | C21H35N5O2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | (2S)-N-[(2S)-2-(tert-butylamino)-4,4-dimethyl-3-oxopentyl]-2-(diaminomethylideneamino)-3-phenylpropanamide |
| SMILES | CC(C)(C)N[C@@H](CNC(=O)[C@H](Cc1ccccc1)N=C(N)N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C21H35N5O2/c1-20(2,3)17(27)16(26-21(4,5)6)13-24-18(28)15(25-19(22)23)12-14-10-8-7-9-11-14/h7-11,15-16,26H,12-13H2,1-6H3,(H,24,28)(H4,22,23,25)/t15-,16-/m0/s1 |
| InChIKey | MTNNOCRKBXHEGL-HOTGVXAUSA-N |
| XLogP | 1.36 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|