C15H20LiNO4 — CID 101032578
lithium N-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate (PubChem CID 101032578) has the molecular formula C15H20LiNO4 and a molecular weight of 285.27 g/mol. Its IUPAC name is lithium N-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate.
| Compound Name | lithium N-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
|---|---|
| PubChem CID | 101032578 |
| Molecular Formula | C15H20LiNO4 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | lithium N-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)/N=C(\[O-])OC(C)(C)C.[Li+] |
| InChI | InChI=1S/C15H21NO4.Li/c1-15(2,3)20-14(18)16-12(13(17)19-4)10-11-8-6-5-7-9-11;/h5-9,12H,10H2,1-4H3,(H,16,18);/q;+1/p-1/t12-;/m0./s1 |
| InChIKey | DPXNQJDZBIUTBN-YDALLXLXSA-M |
| XLogP | -1.69 |
| TPSA | 70.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|