C24H21Cl2NO2 — CID 134873104
methyl 2-[(1,2-dichloro-2,2-diphenylethylidene)amino]-3-phenylpropanoate (PubChem CID 134873104) has the molecular formula C24H21Cl2NO2 and a molecular weight of 426.34 g/mol. Its IUPAC name is methyl 2-[(1,2-dichloro-2,2-diphenylethylidene)amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[(1,2-dichloro-2,2-diphenylethylidene)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 134873104 |
| Molecular Formula | C24H21Cl2NO2 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | methyl 2-[(1,2-dichloro-2,2-diphenylethylidene)amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)/N=C(\Cl)C(Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21Cl2NO2/c1-29-22(28)21(17-18-11-5-2-6-12-18)27-23(25)24(26,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21H,17H2,1H3/b27-23- |
| InChIKey | DKUBYSREAJVTAT-VYIQYICTSA-N |
| XLogP | 5.59 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|