C29H28N4O6Pd — CID 15973834
acetonitrile;2-N,6-N-bis[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]pyridine-2,6-dicarboximidate;palladium(2+) (PubChem CID 15973834) has the molecular formula C29H28N4O6Pd and a molecular weight of 634.99 g/mol. Its IUPAC name is acetonitrile;2-N,6-N-bis[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]pyridine-2,6-dicarboximidate;palladium(2+).
| Compound Name | acetonitrile;2-N,6-N-bis[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]pyridine-2,6-dicarboximidate;palladium(2+) |
|---|---|
| PubChem CID | 15973834 |
| Molecular Formula | C29H28N4O6Pd |
| Molecular Weight | 634.99 g/mol |
| Exact Mass | 634.10 |
| IUPAC Name | acetonitrile;2-N,6-N-bis[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]pyridine-2,6-dicarboximidate;palladium(2+) |
| SMILES | CC#N.COC(=O)[C@H](Cc1ccccc1)/N=C(\[O-])c1cccc(/C([O-])=N/[C@@H](Cc2ccccc2)C(=O)OC)n1.[Pd+2] |
| InChI | InChI=1S/C27H27N3O6.C2H3N.Pd/c1-35-26(33)22(16-18-10-5-3-6-11-18)29-24(31)20-14-9-15-21(28-20)25(32)30-23(27(34)36-2)17-19-12-7-4-8-13-19;1-2-3;/h3-15,22-23H,16-17H2,1-2H3,(H,29,31)(H,30,32);1H3;/q;;+2/p-2/t22-,23-;;/m0../s1 |
| InChIKey | DBJBZMQPZNMWJB-YPSJUKSRSA-L |
| XLogP | 1.39 |
| TPSA | 160.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.99 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|