C13H16N3NaO3 — CID 110191354
sodium;(2S)-2-[1-(cyanoamino)ethylideneamino]-3-phenylpropanoate;methanol (PubChem CID 110191354) has the molecular formula C13H16N3NaO3 and a molecular weight of 285.28 g/mol. Its IUPAC name is sodium;(2S)-2-[1-(cyanoamino)ethylideneamino]-3-phenylpropanoate;methanol.
| Compound Name | sodium;(2S)-2-[1-(cyanoamino)ethylideneamino]-3-phenylpropanoate;methanol |
|---|---|
| PubChem CID | 110191354 |
| Molecular Formula | C13H16N3NaO3 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | sodium;(2S)-2-[1-(cyanoamino)ethylideneamino]-3-phenylpropanoate;methanol |
| SMILES | C/C(=N\[C@@H](Cc1ccccc1)C(=O)[O-])NC#N.CO.[Na+] |
| InChI | InChI=1S/C12H13N3O2.CH4O.Na/c1-9(14-8-13)15-11(12(16)17)7-10-5-3-2-4-6-10;1-2;/h2-6,11H,7H2,1H3,(H,14,15)(H,16,17);2H,1H3;/q;;+1/p-1/t11-;;/m0../s1 |
| InChIKey | NNKINWJSJLYSFF-IDMXKUIJSA-M |
| XLogP | -3.55 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|