C19H19N3O2 — CID 110191304
(2R)-2-[[1-(cyanoamino)-2-(4-methylphenyl)ethylidene]amino]-3-phenylpropanoic acid (PubChem CID 110191304) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is (2R)-2-[[1-(cyanoamino)-2-(4-methylphenyl)ethylidene]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[1-(cyanoamino)-2-(4-methylphenyl)ethylidene]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 110191304 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (2R)-2-[[1-(cyanoamino)-2-(4-methylphenyl)ethylidene]amino]-3-phenylpropanoic acid |
| SMILES | Cc1ccc(C/C(=N\[C@H](Cc2ccccc2)C(=O)O)NC#N)cc1 |
| InChI | InChI=1S/C19H19N3O2/c1-14-7-9-16(10-8-14)12-18(21-13-20)22-17(19(23)24)11-15-5-3-2-4-6-15/h2-10,17H,11-12H2,1H3,(H,21,22)(H,23,24)/t17-/m1/s1 |
| InChIKey | AJRMNVGFNRJTAW-QGZVFWFLSA-N |
| XLogP | 2.70 |
| TPSA | 85.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|