C26H27NO2 — CID 102180330
(2R)-2-(benzhydrylideneamino)-3-(4-tert-butylphenyl)propanoic acid (PubChem CID 102180330) has the molecular formula C26H27NO2 and a molecular weight of 385.51 g/mol. Its IUPAC name is (2R)-2-(benzhydrylideneamino)-3-(4-tert-butylphenyl)propanoic acid.
| Compound Name | (2R)-2-(benzhydrylideneamino)-3-(4-tert-butylphenyl)propanoic acid |
|---|---|
| PubChem CID | 102180330 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (2R)-2-(benzhydrylideneamino)-3-(4-tert-butylphenyl)propanoic acid |
| SMILES | CC(C)(C)c1ccc(C[C@@H](N=C(c2ccccc2)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C26H27NO2/c1-26(2,3)22-16-14-19(15-17-22)18-23(25(28)29)27-24(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17,23H,18H2,1-3H3,(H,28,29)/t23-/m1/s1 |
| InChIKey | STPNJOYICMTHNQ-HSZRJFAPSA-N |
| XLogP | 5.52 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|