C22H17Br2NO2 — CID 175585178
2-(benzhydrylideneamino)-3-(3,5-dibromophenyl)propanoic acid (PubChem CID 175585178) has the molecular formula C22H17Br2NO2 and a molecular weight of 487.19 g/mol. Its IUPAC name is 2-(benzhydrylideneamino)-3-(3,5-dibromophenyl)propanoic acid.
| Compound Name | 2-(benzhydrylideneamino)-3-(3,5-dibromophenyl)propanoic acid |
|---|---|
| PubChem CID | 175585178 |
| Molecular Formula | C22H17Br2NO2 |
| Molecular Weight | 487.19 g/mol |
| Exact Mass | 484.96 |
| IUPAC Name | 2-(benzhydrylideneamino)-3-(3,5-dibromophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1cc(Br)cc(Br)c1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H17Br2NO2/c23-18-11-15(12-19(24)14-18)13-20(22(26)27)25-21(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-12,14,20H,13H2,(H,26,27) |
| InChIKey | KHCZTUFSLDWONE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.19 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|