C24H28F3NO2 — CID 174936301
2-(benzhydrylideneamino)-7-fluoro-5,5-bis(2-fluoroethyl)heptanoic acid (PubChem CID 174936301) has the molecular formula C24H28F3NO2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 2-(benzhydrylideneamino)-7-fluoro-5,5-bis(2-fluoroethyl)heptanoic acid.
| Compound Name | 2-(benzhydrylideneamino)-7-fluoro-5,5-bis(2-fluoroethyl)heptanoic acid |
|---|---|
| PubChem CID | 174936301 |
| Molecular Formula | C24H28F3NO2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2-(benzhydrylideneamino)-7-fluoro-5,5-bis(2-fluoroethyl)heptanoic acid |
| SMILES | O=C(O)C(CCC(CCF)(CCF)CCF)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28F3NO2/c25-16-13-24(14-17-26,15-18-27)12-11-21(23(29)30)28-22(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-10,21H,11-18H2,(H,29,30) |
| InChIKey | FMAJITWEXVRCPA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|