C19H21N3O2 — CID 110191245
N-cyano-N'-[(3,4-dimethoxyphenyl)methyl]-2-(4-methylphenyl)ethanimidamide (PubChem CID 110191245) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-cyano-N'-[(3,4-dimethoxyphenyl)methyl]-2-(4-methylphenyl)ethanimidamide.
| Compound Name | N-cyano-N'-[(3,4-dimethoxyphenyl)methyl]-2-(4-methylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 110191245 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-cyano-N'-[(3,4-dimethoxyphenyl)methyl]-2-(4-methylphenyl)ethanimidamide |
| SMILES | COc1ccc(C/N=C(/Cc2ccc(C)cc2)NC#N)cc1OC |
| InChI | InChI=1S/C19H21N3O2/c1-14-4-6-15(7-5-14)11-19(22-13-20)21-12-16-8-9-17(23-2)18(10-16)24-3/h4-10H,11-12H2,1-3H3,(H,21,22) |
| InChIKey | WTZURGXNDCJJHM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|