C11H13N3 — CID 10219732
N-cyano-N'-[(3-methylphenyl)methyl]ethanimidamide (PubChem CID 10219732) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is N-cyano-N'-[(3-methylphenyl)methyl]ethanimidamide.
| Compound Name | N-cyano-N'-[(3-methylphenyl)methyl]ethanimidamide |
|---|---|
| PubChem CID | 10219732 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | N-cyano-N'-[(3-methylphenyl)methyl]ethanimidamide |
| SMILES | C/C(=N\Cc1cccc(C)c1)NC#N |
| InChI | InChI=1S/C11H13N3/c1-9-4-3-5-11(6-9)7-13-10(2)14-8-12/h3-6H,7H2,1-2H3,(H,13,14) |
| InChIKey | NXFKAKDFAWTHDZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|