C15H24IN3 — CID 110956795
N-ethyl-N'-[(3-methylphenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 110956795) has the molecular formula C15H24IN3 and a molecular weight of 373.28 g/mol. Its IUPAC name is N-ethyl-N'-[(3-methylphenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(3-methylphenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110956795 |
| Molecular Formula | C15H24IN3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-ethyl-N'-[(3-methylphenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C)c1)N1CCCC1.I |
| InChI | InChI=1S/C15H23N3.HI/c1-3-16-15(18-9-4-5-10-18)17-12-14-8-6-7-13(2)11-14;/h6-8,11H,3-5,9-10,12H2,1-2H3,(H,16,17);1H |
| InChIKey | WDLKAPHNJNITAB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|