C18H30N4 — CID 159070681
N-propan-2-yl-N'-[[3-[[1-(propan-2-ylamino)ethylideneamino]methyl]phenyl]methyl]ethanimidamide (PubChem CID 159070681) has the molecular formula C18H30N4 and a molecular weight of 302.47 g/mol. Its IUPAC name is N-propan-2-yl-N'-[[3-[[1-(propan-2-ylamino)ethylideneamino]methyl]phenyl]methyl]ethanimidamide.
| Compound Name | N-propan-2-yl-N'-[[3-[[1-(propan-2-ylamino)ethylideneamino]methyl]phenyl]methyl]ethanimidamide |
|---|---|
| PubChem CID | 159070681 |
| Molecular Formula | C18H30N4 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | N-propan-2-yl-N'-[[3-[[1-(propan-2-ylamino)ethylideneamino]methyl]phenyl]methyl]ethanimidamide |
| SMILES | C/C(=N\Cc1cccc(C/N=C(\C)NC(C)C)c1)NC(C)C |
| InChI | InChI=1S/C18H30N4/c1-13(2)21-15(5)19-11-17-8-7-9-18(10-17)12-20-16(6)22-14(3)4/h7-10,13-14H,11-12H2,1-6H3,(H,19,21)(H,20,22) |
| InChIKey | IXMLLWSCXGWARE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|