C19H30N2 — CID 21022148
4-methyl-N-[[3-(4-methylpentan-2-ylideneamino)phenyl]methyl]pentan-2-imine (PubChem CID 21022148) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 4-methyl-N-[[3-(4-methylpentan-2-ylideneamino)phenyl]methyl]pentan-2-imine.
| Compound Name | 4-methyl-N-[[3-(4-methylpentan-2-ylideneamino)phenyl]methyl]pentan-2-imine |
|---|---|
| PubChem CID | 21022148 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 4-methyl-N-[[3-(4-methylpentan-2-ylideneamino)phenyl]methyl]pentan-2-imine |
| SMILES | C/C(CC(C)C)=N\Cc1cccc(/N=C(\C)CC(C)C)c1 |
| InChI | InChI=1S/C19H30N2/c1-14(2)10-16(5)20-13-18-8-7-9-19(12-18)21-17(6)11-15(3)4/h7-9,12,14-15H,10-11,13H2,1-6H3/b20-16+,21-17+ |
| InChIKey | XLGONTXCEGDBPF-NWILIBCHSA-N |
| XLogP | 5.83 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|